C6H3F3NO2- — CID 154048908
2-cyano-5,5,5-trifluoropent-2-enoate (PubChem CID 154048908) has the molecular formula C6H3F3NO2- and a molecular weight of 178.09 g/mol. Its IUPAC name is 2-cyano-5,5,5-trifluoropent-2-enoate.
| Compound Name | 2-cyano-5,5,5-trifluoropent-2-enoate |
|---|---|
| PubChem CID | 154048908 |
| Molecular Formula | C6H3F3NO2- |
| Molecular Weight | 178.09 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | 2-cyano-5,5,5-trifluoropent-2-enoate |
| SMILES | N#CC(=CCC(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C6H4F3NO2/c7-6(8,9)2-1-4(3-10)5(11)12/h1H,2H2,(H,11,12)/p-1 |
| InChIKey | WONGANLRPXCJCT-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.09 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|