C8H10F3O2- — CID 154181955
2-tert-butyl-4,4,4-trifluorobut-2-enoate (PubChem CID 154181955) has the molecular formula C8H10F3O2- and a molecular weight of 195.16 g/mol. Its IUPAC name is 2-tert-butyl-4,4,4-trifluorobut-2-enoate.
| Compound Name | 2-tert-butyl-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 154181955 |
| Molecular Formula | C8H10F3O2- |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2-tert-butyl-4,4,4-trifluorobut-2-enoate |
| SMILES | CC(C)(C)C(=CC(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C8H11F3O2/c1-7(2,3)5(6(12)13)4-8(9,10)11/h4H,1-3H3,(H,12,13)/p-1 |
| InChIKey | DZKMDUCJZHIRDL-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|