C5H4F3O2Sm+2 — CID 15242750
samarium(3+);(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-olate (PubChem CID 15242750) has the molecular formula C5H4F3O2Sm+2 and a molecular weight of 303.44 g/mol. Its IUPAC name is samarium(3+);(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-olate.
| Compound Name | samarium(3+);(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-olate |
|---|---|
| PubChem CID | 15242750 |
| Molecular Formula | C5H4F3O2Sm+2 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 304.93 |
| IUPAC Name | samarium(3+);(Z)-1,1,1-trifluoro-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)/C=C(\[O-])C(F)(F)F.[Sm+3] |
| InChI | InChI=1S/C5H5F3O2.Sm/c1-3(9)2-4(10)5(6,7)8;/h2,10H,1H3;/q;+3/p-1/b4-2-; |
| InChIKey | OPHLAYIFMBUCKH-MKHFZPSSSA-M |
| XLogP | 0.38 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|