C7H2F6Li2O3 — CID 91926473
dilithium;(2Z,5Z)-1,1,1,7,7,7-hexafluoro-4-oxohepta-2,5-diene-2,6-diolate (PubChem CID 91926473) has the molecular formula C7H2F6Li2O3 and a molecular weight of 261.96 g/mol. Its IUPAC name is dilithium;(2Z,5Z)-1,1,1,7,7,7-hexafluoro-4-oxohepta-2,5-diene-2,6-diolate.
| Compound Name | dilithium;(2Z,5Z)-1,1,1,7,7,7-hexafluoro-4-oxohepta-2,5-diene-2,6-diolate |
|---|---|
| PubChem CID | 91926473 |
| Molecular Formula | C7H2F6Li2O3 |
| Molecular Weight | 261.96 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | dilithium;(2Z,5Z)-1,1,1,7,7,7-hexafluoro-4-oxohepta-2,5-diene-2,6-diolate |
| SMILES | O=C(/C=C(\[O-])C(F)(F)F)/C=C(\[O-])C(F)(F)F.[Li+].[Li+] |
| InChI | InChI=1S/C7H4F6O3.2Li/c8-6(9,10)4(15)1-3(14)2-5(16)7(11,12)13;;/h1-2,15-16H;;/q;2*+1/p-2/b4-1-,5-2-;; |
| InChIKey | YHHYLRLBAWWZRR-DBBVHVSXSA-L |
| XLogP | -5.82 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.96 |
| LogP ≤ 5 | -5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|