C3H2Cl2F2 — CID 71361640
1,1-dichloro-3,3-difluoroprop-1-ene (PubChem CID 71361640) has the molecular formula C3H2Cl2F2 and a molecular weight of 146.95 g/mol. Its IUPAC name is 1,1-dichloro-3,3-difluoroprop-1-ene.
| Compound Name | 1,1-dichloro-3,3-difluoroprop-1-ene |
|---|---|
| PubChem CID | 71361640 |
| Molecular Formula | C3H2Cl2F2 |
| Molecular Weight | 146.95 g/mol |
| Exact Mass | 145.95 |
| IUPAC Name | 1,1-dichloro-3,3-difluoroprop-1-ene |
| SMILES | FC(F)C=C(Cl)Cl |
| InChI | InChI=1S/C3H2Cl2F2/c4-2(5)1-3(6)7/h1,3H |
| InChIKey | WZBFBGLQXCGMFG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.95 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |