C8H8Cl6O — CID 10903722
2,2,4,6,6-pentachloro-3,3-dimethylhex-5-enoyl chloride (PubChem CID 10903722) has the molecular formula C8H8Cl6O and a molecular weight of 332.87 g/mol. Its IUPAC name is 2,2,4,6,6-pentachloro-3,3-dimethylhex-5-enoyl chloride.
| Compound Name | 2,2,4,6,6-pentachloro-3,3-dimethylhex-5-enoyl chloride |
|---|---|
| PubChem CID | 10903722 |
| Molecular Formula | C8H8Cl6O |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 329.87 |
| IUPAC Name | 2,2,4,6,6-pentachloro-3,3-dimethylhex-5-enoyl chloride |
| SMILES | CC(C)(C(Cl)C=C(Cl)Cl)C(Cl)(Cl)C(=O)Cl |
| InChI | InChI=1S/C8H8Cl6O/c1-7(2,4(9)3-5(10)11)8(13,14)6(12)15/h3-4H,1-2H3 |
| InChIKey | LNHKDDXNJUWPHQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|