C6H4Cl8 — CID 154425891
1,1,3,4,4,5,6,6-octachlorohex-1-ene (PubChem CID 154425891) has the molecular formula C6H4Cl8 and a molecular weight of 359.72 g/mol. Its IUPAC name is 1,1,3,4,4,5,6,6-octachlorohex-1-ene.
| Compound Name | 1,1,3,4,4,5,6,6-octachlorohex-1-ene |
|---|---|
| PubChem CID | 154425891 |
| Molecular Formula | C6H4Cl8 |
| Molecular Weight | 359.72 g/mol |
| Exact Mass | 355.78 |
| IUPAC Name | 1,1,3,4,4,5,6,6-octachlorohex-1-ene |
| SMILES | ClC(Cl)=CC(Cl)C(Cl)(Cl)C(Cl)C(Cl)Cl |
| InChI | InChI=1S/C6H4Cl8/c7-2(1-3(8)9)6(13,14)4(10)5(11)12/h1-2,4-5H |
| InChIKey | MJUNFHXFCPXPNW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|