C6H4Cl10 — CID 119097624
1,1,2,2,3,4,5,5,6,6-decachlorohexane (PubChem CID 119097624) has the molecular formula C6H4Cl10 and a molecular weight of 430.63 g/mol. Its IUPAC name is 1,1,2,2,3,4,5,5,6,6-decachlorohexane.
| Compound Name | 1,1,2,2,3,4,5,5,6,6-decachlorohexane |
|---|---|
| PubChem CID | 119097624 |
| Molecular Formula | C6H4Cl10 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 425.72 |
| IUPAC Name | 1,1,2,2,3,4,5,5,6,6-decachlorohexane |
| SMILES | ClC(Cl)C(Cl)(Cl)C(Cl)C(Cl)C(Cl)(Cl)C(Cl)Cl |
| InChI | InChI=1S/C6H4Cl10/c7-1(5(13,14)3(9)10)2(8)6(15,16)4(11)12/h1-4H |
| InChIKey | UNUKVYSMFWDRHZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|