C5H5Cl7 — CID 174383953
1,1,2,2,3,4,5-heptachloropentane (PubChem CID 174383953) has the molecular formula C5H5Cl7 and a molecular weight of 313.27 g/mol. Its IUPAC name is 1,1,2,2,3,4,5-heptachloropentane.
| Compound Name | 1,1,2,2,3,4,5-heptachloropentane |
|---|---|
| PubChem CID | 174383953 |
| Molecular Formula | C5H5Cl7 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 309.82 |
| IUPAC Name | 1,1,2,2,3,4,5-heptachloropentane |
| SMILES | ClCC(Cl)C(Cl)C(Cl)(Cl)C(Cl)Cl |
| InChI | InChI=1S/C5H5Cl7/c6-1-2(7)3(8)5(11,12)4(9)10/h2-4H,1H2 |
| InChIKey | FNIKVMLWLHOJDQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|