C5H2Cl10 — CID 22027028
1,1,1,2,2,3,4,5,5,5-decachloropentane (PubChem CID 22027028) has the molecular formula C5H2Cl10 and a molecular weight of 416.60 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,5,5,5-decachloropentane.
| Compound Name | 1,1,1,2,2,3,4,5,5,5-decachloropentane |
|---|---|
| PubChem CID | 22027028 |
| Molecular Formula | C5H2Cl10 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 411.70 |
| IUPAC Name | 1,1,1,2,2,3,4,5,5,5-decachloropentane |
| SMILES | ClC(C(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H2Cl10/c6-1(2(7)4(10,11)12)3(8,9)5(13,14)15/h1-2H |
| InChIKey | BCFNCPFDOWQWDP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|