C6H8Cl6 — CID 22151176
1,1,1,2,2,3-hexachlorohexane (PubChem CID 22151176) has the molecular formula C6H8Cl6 and a molecular weight of 292.85 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexachlorohexane.
| Compound Name | 1,1,1,2,2,3-hexachlorohexane |
|---|---|
| PubChem CID | 22151176 |
| Molecular Formula | C6H8Cl6 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 289.88 |
| IUPAC Name | 1,1,1,2,2,3-hexachlorohexane |
| SMILES | CCCC(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl6/c1-2-3-4(7)5(8,9)6(10,11)12/h4H,2-3H2,1H3 |
| InChIKey | NGIPHSLFEODPTK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|