C7H13Cl3O3 — CID 118276338
2,2,3-trichloroheptane-1,1,1-triol (PubChem CID 118276338) has the molecular formula C7H13Cl3O3 and a molecular weight of 251.54 g/mol. Its IUPAC name is 2,2,3-trichloroheptane-1,1,1-triol.
| Compound Name | 2,2,3-trichloroheptane-1,1,1-triol |
|---|---|
| PubChem CID | 118276338 |
| Molecular Formula | C7H13Cl3O3 |
| Molecular Weight | 251.54 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 2,2,3-trichloroheptane-1,1,1-triol |
| SMILES | CCCCC(Cl)C(Cl)(Cl)C(O)(O)O |
| InChI | InChI=1S/C7H13Cl3O3/c1-2-3-4-5(8)6(9,10)7(11,12)13/h5,11-13H,2-4H2,1H3 |
| InChIKey | YIKFOZNHFYCUTH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.54 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|