C10H15Cl7O — CID 141280857
2,2,3,3,4,4,5-heptachlorodecan-1-ol (PubChem CID 141280857) has the molecular formula C10H15Cl7O and a molecular weight of 399.40 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptachlorodecan-1-ol.
| Compound Name | 2,2,3,3,4,4,5-heptachlorodecan-1-ol |
|---|---|
| PubChem CID | 141280857 |
| Molecular Formula | C10H15Cl7O |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 2,2,3,3,4,4,5-heptachlorodecan-1-ol |
| SMILES | CCCCCC(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)CO |
| InChI | InChI=1S/C10H15Cl7O/c1-2-3-4-5-7(11)9(14,15)10(16,17)8(12,13)6-18/h7,18H,2-6H2,1H3 |
| InChIKey | ADVBGMIGXCLOKN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|