C12H18Br6Cl2 — CID 88623568
1,1,1,2,2,3-hexabromo-3,4-dichlorododecane (PubChem CID 88623568) has the molecular formula C12H18Br6Cl2 and a molecular weight of 712.61 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexabromo-3,4-dichlorododecane.
| Compound Name | 1,1,1,2,2,3-hexabromo-3,4-dichlorododecane |
|---|---|
| PubChem CID | 88623568 |
| Molecular Formula | C12H18Br6Cl2 |
| Molecular Weight | 712.61 g/mol |
| Exact Mass | 705.59 |
| IUPAC Name | 1,1,1,2,2,3-hexabromo-3,4-dichlorododecane |
| SMILES | CCCCCCCCC(Cl)C(Cl)(Br)C(Br)(Br)C(Br)(Br)Br |
| InChI | InChI=1S/C12H18Br6Cl2/c1-2-3-4-5-6-7-8-9(19)10(13,20)11(14,15)12(16,17)18/h9H,2-8H2,1H3 |
| InChIKey | AYLBDNLBOZVZPB-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.61 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|