C14H24Cl2 — CID 150880814
3,4-dichloro-3-ethenyldodec-1-ene (PubChem CID 150880814) has the molecular formula C14H24Cl2 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3,4-dichloro-3-ethenyldodec-1-ene.
| Compound Name | 3,4-dichloro-3-ethenyldodec-1-ene |
|---|---|
| PubChem CID | 150880814 |
| Molecular Formula | C14H24Cl2 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3,4-dichloro-3-ethenyldodec-1-ene |
| SMILES | C=CC(Cl)(C=C)C(Cl)CCCCCCCC |
| InChI | InChI=1S/C14H24Cl2/c1-4-7-8-9-10-11-12-13(15)14(16,5-2)6-3/h5-6,13H,2-4,7-12H2,1H3 |
| InChIKey | KVYYFTWVUGGGCS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|