C16H21Cl5 — CID 150798640
1,1,1,2,3-pentachlorodecan-2-ylbenzene (PubChem CID 150798640) has the molecular formula C16H21Cl5 and a molecular weight of 390.61 g/mol. Its IUPAC name is 1,1,1,2,3-pentachlorodecan-2-ylbenzene.
| Compound Name | 1,1,1,2,3-pentachlorodecan-2-ylbenzene |
|---|---|
| PubChem CID | 150798640 |
| Molecular Formula | C16H21Cl5 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | 1,1,1,2,3-pentachlorodecan-2-ylbenzene |
| SMILES | CCCCCCCC(Cl)C(Cl)(c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H21Cl5/c1-2-3-4-5-9-12-14(17)15(18,16(19,20)21)13-10-7-6-8-11-13/h6-8,10-11,14H,2-5,9,12H2,1H3 |
| InChIKey | KFJMQXSZXAFFCO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|