C18H25Br5 — CID 67852937
1,1,2,2,3-pentabromododecylbenzene (PubChem CID 67852937) has the molecular formula C18H25Br5 and a molecular weight of 640.92 g/mol. Its IUPAC name is 1,1,2,2,3-pentabromododecylbenzene.
| Compound Name | 1,1,2,2,3-pentabromododecylbenzene |
|---|---|
| PubChem CID | 67852937 |
| Molecular Formula | C18H25Br5 |
| Molecular Weight | 640.92 g/mol |
| Exact Mass | 635.79 |
| IUPAC Name | 1,1,2,2,3-pentabromododecylbenzene |
| SMILES | CCCCCCCCCC(Br)C(Br)(Br)C(Br)(Br)c1ccccc1 |
| InChI | InChI=1S/C18H25Br5/c1-2-3-4-5-6-7-11-14-16(19)18(22,23)17(20,21)15-12-9-8-10-13-15/h8-10,12-13,16H,2-7,11,14H2,1H3 |
| InChIKey | CRTZMROWOHXYIK-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.92 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|