C10H16Br2ClF3 — CID 94841903
(2S,4R)-1,4-dibromo-2-chloro-1,1,2-trifluorodecane (PubChem CID 94841903) has the molecular formula C10H16Br2ClF3 and a molecular weight of 388.49 g/mol. Its IUPAC name is (2S,4R)-1,4-dibromo-2-chloro-1,1,2-trifluorodecane.
| Compound Name | (2S,4R)-1,4-dibromo-2-chloro-1,1,2-trifluorodecane |
|---|---|
| PubChem CID | 94841903 |
| Molecular Formula | C10H16Br2ClF3 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | (2S,4R)-1,4-dibromo-2-chloro-1,1,2-trifluorodecane |
| SMILES | CCCCCC[C@@H](Br)C[C@](F)(Cl)C(F)(F)Br |
| InChI | InChI=1S/C10H16Br2ClF3/c1-2-3-4-5-6-8(11)7-9(13,14)10(12,15)16/h8H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | IVXKUGOCECZHGU-RKDXNWHRSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|