C10H14Cl8O — CID 141280828
2,2,3,3,4,4,5,5-octachlorodecan-1-ol (PubChem CID 141280828) has the molecular formula C10H14Cl8O and a molecular weight of 433.85 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octachlorodecan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5-octachlorodecan-1-ol |
|---|---|
| PubChem CID | 141280828 |
| Molecular Formula | C10H14Cl8O |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 429.86 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octachlorodecan-1-ol |
| SMILES | CCCCCC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)CO |
| InChI | InChI=1S/C10H14Cl8O/c1-2-3-4-5-7(11,12)9(15,16)10(17,18)8(13,14)6-19/h19H,2-6H2,1H3 |
| InChIKey | FBJGUKYQSRQJTQ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|