C11H17Cl7 — CID 170849896
1,1,1,2,2,3,3-heptachloroundecane (PubChem CID 170849896) has the molecular formula C11H17Cl7 and a molecular weight of 397.43 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptachloroundecane.
| Compound Name | 1,1,1,2,2,3,3-heptachloroundecane |
|---|---|
| PubChem CID | 170849896 |
| Molecular Formula | C11H17Cl7 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 393.91 |
| IUPAC Name | 1,1,1,2,2,3,3-heptachloroundecane |
| SMILES | CCCCCCCCC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H17Cl7/c1-2-3-4-5-6-7-8-9(12,13)10(14,15)11(16,17)18/h2-8H2,1H3 |
| InChIKey | AZPJTJPEXNPTKT-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|