About azane;9-chloro-9-octyloctadecane;hydron
azane;9-chloro-9-octyloctadecane;hydron (PubChem CID 22328165) has the molecular formula C26H57ClN+
and a molecular weight of 419.20 g/mol. Its IUPAC name is azane;9-chloro-9-octyloctadecane;hydron.
Molecular Properties
| Compound Name | azane;9-chloro-9-octyloctadecane;hydron |
| PubChem CID | 22328165 |
| Molecular Formula | C26H57ClN+ |
| Molecular Weight | 419.20 g/mol |
| Exact Mass | 418.42 |
| IUPAC Name | azane;9-chloro-9-octyloctadecane;hydron |
| SMILES | CCCCCCCCCC(Cl)(CCCCCCCC)CCCCCCCC.N.[H+] |
| InChI | InChI=1S/C26H53Cl.H3N/c1-4-7-10-13-16-19-22-25-26(27,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h4-25H2,1-3H3;1H3/p+1 |
| InChIKey | JMKNUFHRPVWHJO-UHFFFAOYSA-O |
| XLogP | 10.88 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.20 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;9-chloro-9-octyloctadecane;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;9-chloro-9-octyloctadecane;hydron?
The IUPAC name of azane;9-chloro-9-octyloctadecane;hydron (CID 22328165) is azane;9-chloro-9-octyloctadecane;hydron.
What is the SMILES notation for azane;9-chloro-9-octyloctadecane;hydron?
The canonical SMILES for azane;9-chloro-9-octyloctadecane;hydron is CCCCCCCCCC(Cl)(CCCCCCCC)CCCCCCCC.N.[H+].
What is the InChIKey of azane;9-chloro-9-octyloctadecane;hydron?
The InChIKey is JMKNUFHRPVWHJO-UHFFFAOYSA-O. The full InChI is InChI=1S/C26H53Cl.H3N/c1-4-7-10-13-16-19-22-25-26(27,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;/h4-25H2,1-3H3;1H3/p+1.
What are the key properties of azane;9-chloro-9-octyloctadecane;hydron?
azane;9-chloro-9-octyloctadecane;hydron has a molecular weight of 419.20 g/mol, XLogP of 10.88, 22 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;9-chloro-9-octyloctadecane;hydron is sourced from PubChem (CID 22328165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).