C22H44Cl2 — CID 101326061
4,13-dichloro-4,13-dipropylhexadecane (PubChem CID 101326061) has the molecular formula C22H44Cl2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4,13-dichloro-4,13-dipropylhexadecane.
| Compound Name | 4,13-dichloro-4,13-dipropylhexadecane |
|---|---|
| PubChem CID | 101326061 |
| Molecular Formula | C22H44Cl2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 4,13-dichloro-4,13-dipropylhexadecane |
| SMILES | CCCC(Cl)(CCC)CCCCCCCCC(Cl)(CCC)CCC |
| InChI | InChI=1S/C22H44Cl2/c1-5-15-21(23,16-6-2)19-13-11-9-10-12-14-20-22(24,17-7-3)18-8-4/h5-20H2,1-4H3 |
| InChIKey | MOQRKLGMLDDKDA-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|