C7H8Cl8O — CID 141280896
2,2,3,3,4,4,5,5-octachloroheptan-1-ol (PubChem CID 141280896) has the molecular formula C7H8Cl8O and a molecular weight of 391.76 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octachloroheptan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5-octachloroheptan-1-ol |
|---|---|
| PubChem CID | 141280896 |
| Molecular Formula | C7H8Cl8O |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 387.81 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octachloroheptan-1-ol |
| SMILES | CCC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)CO |
| InChI | InChI=1S/C7H8Cl8O/c1-2-4(8,9)6(12,13)7(14,15)5(10,11)3-16/h16H,2-3H2,1H3 |
| InChIKey | NIPHTUJAISMOSX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|