C6H7Cl7O — CID 141280800
2,2,3,3,4,4,5-heptachlorohexan-1-ol (PubChem CID 141280800) has the molecular formula C6H7Cl7O and a molecular weight of 343.29 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptachlorohexan-1-ol.
| Compound Name | 2,2,3,3,4,4,5-heptachlorohexan-1-ol |
|---|---|
| PubChem CID | 141280800 |
| Molecular Formula | C6H7Cl7O |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 339.83 |
| IUPAC Name | 2,2,3,3,4,4,5-heptachlorohexan-1-ol |
| SMILES | CC(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)CO |
| InChI | InChI=1S/C6H7Cl7O/c1-3(7)5(10,11)6(12,13)4(8,9)2-14/h3,14H,2H2,1H3 |
| InChIKey | HQCBUEFCOAPZGT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|