C10H10Cl12O — CID 141280838
2,2,3,3,4,4,5,5,6,6,7,7-dodecachlorodecan-1-ol (PubChem CID 141280838) has the molecular formula C10H10Cl12O and a molecular weight of 571.62 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecachlorodecan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecachlorodecan-1-ol |
|---|---|
| PubChem CID | 141280838 |
| Molecular Formula | C10H10Cl12O |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 565.70 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecachlorodecan-1-ol |
| SMILES | CCCC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)CO |
| InChI | InChI=1S/C10H10Cl12O/c1-2-3-5(11,12)7(15,16)9(19,20)10(21,22)8(17,18)6(13,14)4-23/h23H,2-4H2,1H3 |
| InChIKey | RRPRGAPJRKXQHX-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|