C19H42O — CID 159667667
3,3-diethylhexane;2,2-diethylpentan-1-ol (PubChem CID 159667667) has the molecular formula C19H42O and a molecular weight of 286.54 g/mol. Its IUPAC name is 3,3-diethylhexane;2,2-diethylpentan-1-ol.
| Compound Name | 3,3-diethylhexane;2,2-diethylpentan-1-ol |
|---|---|
| PubChem CID | 159667667 |
| Molecular Formula | C19H42O |
| Molecular Weight | 286.54 g/mol |
| Exact Mass | 286.32 |
| IUPAC Name | 3,3-diethylhexane;2,2-diethylpentan-1-ol |
| SMILES | CCCC(CC)(CC)CC.CCCC(CC)(CC)CO |
| InChI | InChI=1S/C10H22.C9H20O/c1-5-9-10(6-2,7-3)8-4;1-4-7-9(5-2,6-3)8-10/h5-9H2,1-4H3;10H,4-8H2,1-3H3 |
| InChIKey | MTPRKRWXSBKGHR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |