C12H13Cl13 — CID 175011605
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecachloro-10-methylundecane (PubChem CID 175011605) has the molecular formula C12H13Cl13 and a molecular weight of 618.12 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecachloro-10-methylundecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecachloro-10-methylundecane |
|---|---|
| PubChem CID | 175011605 |
| Molecular Formula | C12H13Cl13 |
| Molecular Weight | 618.12 g/mol |
| Exact Mass | 611.70 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecachloro-10-methylundecane |
| SMILES | CC(C)CCCC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl13/c1-6(2)4-3-5-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h6H,3-5H2,1-2H3 |
| InChIKey | COGGMLLMMZZRMP-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.12 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|