C6H8Cl8 — CID 87557158
1,1,1,2-tetrachloropropane (PubChem CID 87557158) has the molecular formula C6H8Cl8 and a molecular weight of 363.75 g/mol. Its IUPAC name is 1,1,1,2-tetrachloropropane.
| Compound Name | 1,1,1,2-tetrachloropropane |
|---|---|
| PubChem CID | 87557158 |
| Molecular Formula | C6H8Cl8 |
| Molecular Weight | 363.75 g/mol |
| Exact Mass | 359.81 |
| IUPAC Name | 1,1,1,2-tetrachloropropane |
| SMILES | CC(Cl)C(Cl)(Cl)Cl.CC(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/2C3H4Cl4/c2*1-2(4)3(5,6)7/h2*2H,1H3 |
| InChIKey | GUHXHUUEEVFHIQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.75 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|