C9H13Cl5O — CID 102588021
2-(1,1,2,2,2-pentachloroethyl)heptanal (PubChem CID 102588021) has the molecular formula C9H13Cl5O and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentachloroethyl)heptanal.
| Compound Name | 2-(1,1,2,2,2-pentachloroethyl)heptanal |
|---|---|
| PubChem CID | 102588021 |
| Molecular Formula | C9H13Cl5O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | 2-(1,1,2,2,2-pentachloroethyl)heptanal |
| SMILES | CCCCCC(C=O)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H13Cl5O/c1-2-3-4-5-7(6-15)8(10,11)9(12,13)14/h6-7H,2-5H2,1H3 |
| InChIKey | IOMKFLYLPCYCGT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|