About 2-aminooctanal
2-aminooctanal (PubChem CID 54076326) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-aminooctanal.
Molecular Properties
| Compound Name | 2-aminooctanal |
| PubChem CID | 54076326 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-aminooctanal |
| SMILES | CCCCCCC(N)C=O |
| InChI | InChI=1S/C8H17NO/c1-2-3-4-5-6-8(9)7-10/h7-8H,2-6,9H2,1H3 |
| InChIKey | MJYSJBBLXCTJAM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-aminooctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooctanal?
The IUPAC name of 2-aminooctanal (CID 54076326) is 2-aminooctanal.
What is the SMILES notation for 2-aminooctanal?
The canonical SMILES for 2-aminooctanal is CCCCCCC(N)C=O.
What is the InChIKey of 2-aminooctanal?
The InChIKey is MJYSJBBLXCTJAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-2-3-4-5-6-8(9)7-10/h7-8H,2-6,9H2,1H3.
What are the key properties of 2-aminooctanal?
2-aminooctanal has a molecular weight of 143.23 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooctanal is sourced from PubChem (CID 54076326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).