About 3-amino-2-methylicosanal
3-amino-2-methylicosanal (PubChem CID 175546884) has the molecular formula C21H43NO
and a molecular weight of 325.58 g/mol. Its IUPAC name is 3-amino-2-methylicosanal.
Molecular Properties
| Compound Name | 3-amino-2-methylicosanal |
| PubChem CID | 175546884 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | 3-amino-2-methylicosanal |
| SMILES | CCCCCCCCCCCCCCCCCC(N)C(C)C=O |
| InChI | InChI=1S/C21H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22)20(2)19-23/h19-21H,3-18,22H2,1-2H3 |
| InChIKey | CMMDPQWWJDLXHH-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-methylicosanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methylicosanal?
The IUPAC name of 3-amino-2-methylicosanal (CID 175546884) is 3-amino-2-methylicosanal.
What is the SMILES notation for 3-amino-2-methylicosanal?
The canonical SMILES for 3-amino-2-methylicosanal is CCCCCCCCCCCCCCCCCC(N)C(C)C=O.
What is the InChIKey of 3-amino-2-methylicosanal?
The InChIKey is CMMDPQWWJDLXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(22)20(2)19-23/h19-21H,3-18,22H2,1-2H3.
What are the key properties of 3-amino-2-methylicosanal?
3-amino-2-methylicosanal has a molecular weight of 325.58 g/mol, XLogP of 6.41, 18 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methylicosanal is sourced from PubChem (CID 175546884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).