About (2S)-2-aminopentanal;ethane;molecular hydrogen
(2S)-2-aminopentanal;ethane;molecular hydrogen (PubChem CID 177242224) has the molecular formula C7H19NO
and a molecular weight of 133.24 g/mol. Its IUPAC name is (2S)-2-aminopentanal;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | (2S)-2-aminopentanal;ethane;molecular hydrogen |
| PubChem CID | 177242224 |
| Molecular Formula | C7H19NO |
| Molecular Weight | 133.24 g/mol |
| Exact Mass | 133.15 |
| IUPAC Name | (2S)-2-aminopentanal;ethane;molecular hydrogen |
| SMILES | CC.CCC[C@H](N)C=O.[H][H] |
| InChI | InChI=1S/C5H11NO.C2H6.H2/c1-2-3-5(6)4-7;1-2;/h4-5H,2-3,6H2,1H3;1-2H3;1H/t5-;;/m0../s1 |
| InChIKey | ZDDNXAMKAYVIPV-XRIGFGBMSA-N |
| XLogP | 1.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopentanal;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanal;ethane;molecular hydrogen?
The IUPAC name of (2S)-2-aminopentanal;ethane;molecular hydrogen (CID 177242224) is (2S)-2-aminopentanal;ethane;molecular hydrogen.
What is the SMILES notation for (2S)-2-aminopentanal;ethane;molecular hydrogen?
The canonical SMILES for (2S)-2-aminopentanal;ethane;molecular hydrogen is CC.CCC[C@H](N)C=O.[H][H].
What is the InChIKey of (2S)-2-aminopentanal;ethane;molecular hydrogen?
The InChIKey is ZDDNXAMKAYVIPV-XRIGFGBMSA-N. The full InChI is InChI=1S/C5H11NO.C2H6.H2/c1-2-3-5(6)4-7;1-2;/h4-5H,2-3,6H2,1H3;1-2H3;1H/t5-;;/m0../s1.
What are the key properties of (2S)-2-aminopentanal;ethane;molecular hydrogen?
(2S)-2-aminopentanal;ethane;molecular hydrogen has a molecular weight of 133.24 g/mol, XLogP of 1.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanal;ethane;molecular hydrogen is sourced from PubChem (CID 177242224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).