About 2-bromopentanal;ethane
2-bromopentanal;ethane (PubChem CID 145429561) has the molecular formula C7H15BrO
and a molecular weight of 195.10 g/mol. Its IUPAC name is 2-bromopentanal;ethane.
Molecular Properties
| Compound Name | 2-bromopentanal;ethane |
| PubChem CID | 145429561 |
| Molecular Formula | C7H15BrO |
| Molecular Weight | 195.10 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-bromopentanal;ethane |
| SMILES | CC.CCCC(Br)C=O |
| InChI | InChI=1S/C5H9BrO.C2H6/c1-2-3-5(6)4-7;1-2/h4-5H,2-3H2,1H3;1-2H3 |
| InChIKey | ITUJVMKDHYCXNO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.10 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopentanal;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopentanal;ethane?
The IUPAC name of 2-bromopentanal;ethane (CID 145429561) is 2-bromopentanal;ethane.
What is the SMILES notation for 2-bromopentanal;ethane?
The canonical SMILES for 2-bromopentanal;ethane is CC.CCCC(Br)C=O.
What is the InChIKey of 2-bromopentanal;ethane?
The InChIKey is ITUJVMKDHYCXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BrO.C2H6/c1-2-3-5(6)4-7;1-2/h4-5H,2-3H2,1H3;1-2H3.
What are the key properties of 2-bromopentanal;ethane?
2-bromopentanal;ethane has a molecular weight of 195.10 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopentanal;ethane is sourced from PubChem (CID 145429561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).