About 2-amino-4-bromobutanal
2-amino-4-bromobutanal (PubChem CID 91331444) has the molecular formula C4H8BrNO
and a molecular weight of 166.02 g/mol. Its IUPAC name is 2-amino-4-bromobutanal.
Molecular Properties
| Compound Name | 2-amino-4-bromobutanal |
| PubChem CID | 91331444 |
| Molecular Formula | C4H8BrNO |
| Molecular Weight | 166.02 g/mol |
| Exact Mass | 164.98 |
| IUPAC Name | 2-amino-4-bromobutanal |
| SMILES | NC(C=O)CCBr |
| InChI | InChI=1S/C4H8BrNO/c5-2-1-4(6)3-7/h3-4H,1-2,6H2 |
| InChIKey | OXQUEJURVNUAIQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.02 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-bromobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-bromobutanal?
The IUPAC name of 2-amino-4-bromobutanal (CID 91331444) is 2-amino-4-bromobutanal.
What is the SMILES notation for 2-amino-4-bromobutanal?
The canonical SMILES for 2-amino-4-bromobutanal is NC(C=O)CCBr.
What is the InChIKey of 2-amino-4-bromobutanal?
The InChIKey is OXQUEJURVNUAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BrNO/c5-2-1-4(6)3-7/h3-4H,1-2,6H2.
What are the key properties of 2-amino-4-bromobutanal?
2-amino-4-bromobutanal has a molecular weight of 166.02 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-bromobutanal is sourced from PubChem (CID 91331444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).