About 1,2,3-tribromo-1,2-dichlorohexane
1,2,3-tribromo-1,2-dichlorohexane (PubChem CID 54426648) has the molecular formula C6H9Br3Cl2
and a molecular weight of 391.76 g/mol. Its IUPAC name is 1,2,3-tribromo-1,2-dichlorohexane.
Molecular Properties
| Compound Name | 1,2,3-tribromo-1,2-dichlorohexane |
| PubChem CID | 54426648 |
| Molecular Formula | C6H9Br3Cl2 |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 387.76 |
| IUPAC Name | 1,2,3-tribromo-1,2-dichlorohexane |
| SMILES | CCCC(Br)C(Cl)(Br)C(Cl)Br |
| InChI | InChI=1S/C6H9Br3Cl2/c1-2-3-4(7)6(9,11)5(8)10/h4-5H,2-3H2,1H3 |
| InChIKey | PANWRPBDOOQXTF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-tribromo-1,2-dichlorohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-tribromo-1,2-dichlorohexane?
The IUPAC name of 1,2,3-tribromo-1,2-dichlorohexane (CID 54426648) is 1,2,3-tribromo-1,2-dichlorohexane.
What is the SMILES notation for 1,2,3-tribromo-1,2-dichlorohexane?
The canonical SMILES for 1,2,3-tribromo-1,2-dichlorohexane is CCCC(Br)C(Cl)(Br)C(Cl)Br.
What is the InChIKey of 1,2,3-tribromo-1,2-dichlorohexane?
The InChIKey is PANWRPBDOOQXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9Br3Cl2/c1-2-3-4(7)6(9,11)5(8)10/h4-5H,2-3H2,1H3.
What are the key properties of 1,2,3-tribromo-1,2-dichlorohexane?
1,2,3-tribromo-1,2-dichlorohexane has a molecular weight of 391.76 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-tribromo-1,2-dichlorohexane is sourced from PubChem (CID 54426648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).