About 1-bromobutylsilane
1-bromobutylsilane (PubChem CID 174507428) has the molecular formula C4H11BrSi
and a molecular weight of 167.12 g/mol. Its IUPAC name is 1-bromobutylsilane.
Molecular Properties
| Compound Name | 1-bromobutylsilane |
| PubChem CID | 174507428 |
| Molecular Formula | C4H11BrSi |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 165.98 |
| IUPAC Name | 1-bromobutylsilane |
| SMILES | CCCC([SiH3])Br |
| InChI | InChI=1S/C4H11BrSi/c1-2-3-4(5)6/h4H,2-3H2,1,6H3 |
| InChIKey | ACMWGORTWMNQOZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-bromobutylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromobutylsilane?
The IUPAC name of 1-bromobutylsilane (CID 174507428) is 1-bromobutylsilane.
What is the SMILES notation for 1-bromobutylsilane?
The canonical SMILES for 1-bromobutylsilane is CCCC([SiH3])Br.
What is the InChIKey of 1-bromobutylsilane?
The InChIKey is ACMWGORTWMNQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11BrSi/c1-2-3-4(5)6/h4H,2-3H2,1,6H3.
What are the key properties of 1-bromobutylsilane?
1-bromobutylsilane has a molecular weight of 167.12 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromobutylsilane is sourced from PubChem (CID 174507428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).