About (2S)-2-bromopentan-1-ol
(2S)-2-bromopentan-1-ol (PubChem CID 101373163) has the molecular formula C5H11BrO
and a molecular weight of 167.05 g/mol. Its IUPAC name is (2S)-2-bromopentan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-bromopentan-1-ol |
| PubChem CID | 101373163 |
| Molecular Formula | C5H11BrO |
| Molecular Weight | 167.05 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | (2S)-2-bromopentan-1-ol |
| SMILES | CCC[C@H](Br)CO |
| InChI | InChI=1S/C5H11BrO/c1-2-3-5(6)4-7/h5,7H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | XESPVLOCYXGKNB-YFKPBYRVSA-N |
| XLogP | 1.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.05 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-bromopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-bromopentan-1-ol?
The IUPAC name of (2S)-2-bromopentan-1-ol (CID 101373163) is (2S)-2-bromopentan-1-ol.
What is the SMILES notation for (2S)-2-bromopentan-1-ol?
The canonical SMILES for (2S)-2-bromopentan-1-ol is CCC[C@H](Br)CO.
What is the InChIKey of (2S)-2-bromopentan-1-ol?
The InChIKey is XESPVLOCYXGKNB-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H11BrO/c1-2-3-5(6)4-7/h5,7H,2-4H2,1H3/t5-/m0/s1.
What are the key properties of (2S)-2-bromopentan-1-ol?
(2S)-2-bromopentan-1-ol has a molecular weight of 167.05 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-bromopentan-1-ol is sourced from PubChem (CID 101373163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).