C6H12F2O — CID 57045572
(2S,3S)-2,3-difluorohexan-1-ol (PubChem CID 57045572) has the molecular formula C6H12F2O and a molecular weight of 138.16 g/mol. Its IUPAC name is (2S,3S)-2,3-difluorohexan-1-ol.
| Compound Name | (2S,3S)-2,3-difluorohexan-1-ol |
|---|---|
| PubChem CID | 57045572 |
| Molecular Formula | C6H12F2O |
| Molecular Weight | 138.16 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | (2S,3S)-2,3-difluorohexan-1-ol |
| SMILES | CCC[C@H](F)[C@@H](F)CO |
| InChI | InChI=1S/C6H12F2O/c1-2-3-5(7)6(8)4-9/h5-6,9H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | NRSQWJSVOPTOBH-WDSKDSINSA-N |
| XLogP | 1.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |