About 2-amino-3-fluorohexanoic acid
2-amino-3-fluorohexanoic acid (PubChem CID 2737444) has the molecular formula C6H12FNO2
and a molecular weight of 149.16 g/mol. Its IUPAC name is 2-amino-3-fluorohexanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-fluorohexanoic acid |
| PubChem CID | 2737444 |
| Molecular Formula | C6H12FNO2 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | 2-amino-3-fluorohexanoic acid |
| SMILES | CCCC(F)C(N)C(=O)O |
| InChI | InChI=1S/C6H12FNO2/c1-2-3-4(7)5(8)6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10) |
| InChIKey | HUPVCGRDUVJYEN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-fluorohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-fluorohexanoic acid?
The IUPAC name of 2-amino-3-fluorohexanoic acid (CID 2737444) is 2-amino-3-fluorohexanoic acid.
What is the SMILES notation for 2-amino-3-fluorohexanoic acid?
The canonical SMILES for 2-amino-3-fluorohexanoic acid is CCCC(F)C(N)C(=O)O.
What is the InChIKey of 2-amino-3-fluorohexanoic acid?
The InChIKey is HUPVCGRDUVJYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FNO2/c1-2-3-4(7)5(8)6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10).
What are the key properties of 2-amino-3-fluorohexanoic acid?
2-amino-3-fluorohexanoic acid has a molecular weight of 149.16 g/mol, XLogP of 0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-fluorohexanoic acid is sourced from PubChem (CID 2737444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).