2-amino-3-fluorohexanoic acid

C6H12FNO2 — CID 2737444

IUPAC2-amino-3-fluorohexanoic acid
SMILESCCCC(F)C(N)C(=O)O
InChIInChI=1S/C6H12FNO2/c1-2-3-4(7)5(8)6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10)
InChIKeyHUPVCGRDUVJYEN-UHFFFAOYSA-N
MW149.16 g/mol
LogP0.54
Rot. Bonds4

About 2-amino-3-fluorohexanoic acid

2-amino-3-fluorohexanoic acid (PubChem CID 2737444) has the molecular formula C6H12FNO2 and a molecular weight of 149.16 g/mol. Its IUPAC name is 2-amino-3-fluorohexanoic acid.

Molecular Properties

Compound Name2-amino-3-fluorohexanoic acid
PubChem CID2737444
Molecular FormulaC6H12FNO2
Molecular Weight149.16 g/mol
Exact Mass149.09
IUPAC Name2-amino-3-fluorohexanoic acid
SMILESCCCC(F)C(N)C(=O)O
InChIInChI=1S/C6H12FNO2/c1-2-3-4(7)5(8)6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10)
InChIKeyHUPVCGRDUVJYEN-UHFFFAOYSA-N
XLogP0.54
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500149.16
LogP ≤ 50.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-3-fluorohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-fluorohexanoic acid?
The IUPAC name of 2-amino-3-fluorohexanoic acid (CID 2737444) is 2-amino-3-fluorohexanoic acid.
What is the SMILES notation for 2-amino-3-fluorohexanoic acid?
The canonical SMILES for 2-amino-3-fluorohexanoic acid is CCCC(F)C(N)C(=O)O.
What is the InChIKey of 2-amino-3-fluorohexanoic acid?
The InChIKey is HUPVCGRDUVJYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FNO2/c1-2-3-4(7)5(8)6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10).
What are the key properties of 2-amino-3-fluorohexanoic acid?
2-amino-3-fluorohexanoic acid has a molecular weight of 149.16 g/mol, XLogP of 0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-fluorohexanoic acid is sourced from PubChem (CID 2737444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).