C8H17FO — CID 130653054
(2S,3R)-2-fluoro-3-methylheptan-1-ol (PubChem CID 130653054) has the molecular formula C8H17FO and a molecular weight of 148.22 g/mol. Its IUPAC name is (2S,3R)-2-fluoro-3-methylheptan-1-ol.
| Compound Name | (2S,3R)-2-fluoro-3-methylheptan-1-ol |
|---|---|
| PubChem CID | 130653054 |
| Molecular Formula | C8H17FO |
| Molecular Weight | 148.22 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (2S,3R)-2-fluoro-3-methylheptan-1-ol |
| SMILES | CCCC[C@@H](C)[C@H](F)CO |
| InChI | InChI=1S/C8H17FO/c1-3-4-5-7(2)8(9)6-10/h7-8,10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | BXQICJHJDGUWNN-HTQZYQBOSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |