About 4-fluoro-3-methyloctane
4-fluoro-3-methyloctane (PubChem CID 89416555) has the molecular formula C9H19F
and a molecular weight of 146.25 g/mol. Its IUPAC name is 4-fluoro-3-methyloctane.
Molecular Properties
| Compound Name | 4-fluoro-3-methyloctane |
| PubChem CID | 89416555 |
| Molecular Formula | C9H19F |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | 4-fluoro-3-methyloctane |
| SMILES | CCCCC(F)C(C)CC |
| InChI | InChI=1S/C9H19F/c1-4-6-7-9(10)8(3)5-2/h8-9H,4-7H2,1-3H3 |
| InChIKey | LEGNPJXNYBYWEH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-fluoro-3-methyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-methyloctane?
The IUPAC name of 4-fluoro-3-methyloctane (CID 89416555) is 4-fluoro-3-methyloctane.
What is the SMILES notation for 4-fluoro-3-methyloctane?
The canonical SMILES for 4-fluoro-3-methyloctane is CCCCC(F)C(C)CC.
What is the InChIKey of 4-fluoro-3-methyloctane?
The InChIKey is LEGNPJXNYBYWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F/c1-4-6-7-9(10)8(3)5-2/h8-9H,4-7H2,1-3H3.
What are the key properties of 4-fluoro-3-methyloctane?
4-fluoro-3-methyloctane has a molecular weight of 146.25 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-methyloctane is sourced from PubChem (CID 89416555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).