About 5-fluoro-6-methyldecane
5-fluoro-6-methyldecane (PubChem CID 123598559) has the molecular formula C11H23F
and a molecular weight of 174.30 g/mol. Its IUPAC name is 5-fluoro-6-methyldecane.
Molecular Properties
| Compound Name | 5-fluoro-6-methyldecane |
| PubChem CID | 123598559 |
| Molecular Formula | C11H23F |
| Molecular Weight | 174.30 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | 5-fluoro-6-methyldecane |
| SMILES | CCCCC(C)C(F)CCCC |
| InChI | InChI=1S/C11H23F/c1-4-6-8-10(3)11(12)9-7-5-2/h10-11H,4-9H2,1-3H3 |
| InChIKey | SSXIEDRDGYTDHS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-fluoro-6-methyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methyldecane?
The IUPAC name of 5-fluoro-6-methyldecane (CID 123598559) is 5-fluoro-6-methyldecane.
What is the SMILES notation for 5-fluoro-6-methyldecane?
The canonical SMILES for 5-fluoro-6-methyldecane is CCCCC(C)C(F)CCCC.
What is the InChIKey of 5-fluoro-6-methyldecane?
The InChIKey is SSXIEDRDGYTDHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23F/c1-4-6-8-10(3)11(12)9-7-5-2/h10-11H,4-9H2,1-3H3.
What are the key properties of 5-fluoro-6-methyldecane?
5-fluoro-6-methyldecane has a molecular weight of 174.30 g/mol, XLogP of 4.34, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methyldecane is sourced from PubChem (CID 123598559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).