About 3-bromo-2,4-dimethylheptane
3-bromo-2,4-dimethylheptane (PubChem CID 79298351) has the molecular formula C9H19Br
and a molecular weight of 207.15 g/mol. Its IUPAC name is 3-bromo-2,4-dimethylheptane.
Molecular Properties
| Compound Name | 3-bromo-2,4-dimethylheptane |
| PubChem CID | 79298351 |
| Molecular Formula | C9H19Br |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-bromo-2,4-dimethylheptane |
| SMILES | CCCC(C)C(Br)C(C)C |
| InChI | InChI=1S/C9H19Br/c1-5-6-8(4)9(10)7(2)3/h7-9H,5-6H2,1-4H3 |
| InChIKey | SIEKOUUHEVAPLZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,4-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4-dimethylheptane?
The IUPAC name of 3-bromo-2,4-dimethylheptane (CID 79298351) is 3-bromo-2,4-dimethylheptane.
What is the SMILES notation for 3-bromo-2,4-dimethylheptane?
The canonical SMILES for 3-bromo-2,4-dimethylheptane is CCCC(C)C(Br)C(C)C.
What is the InChIKey of 3-bromo-2,4-dimethylheptane?
The InChIKey is SIEKOUUHEVAPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19Br/c1-5-6-8(4)9(10)7(2)3/h7-9H,5-6H2,1-4H3.
What are the key properties of 3-bromo-2,4-dimethylheptane?
3-bromo-2,4-dimethylheptane has a molecular weight of 207.15 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-dimethylheptane is sourced from PubChem (CID 79298351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).