About 2-methylhexan-3-ylsilane
2-methylhexan-3-ylsilane (PubChem CID 173259699) has the molecular formula C7H18Si
and a molecular weight of 130.31 g/mol. Its IUPAC name is 2-methylhexan-3-ylsilane.
Molecular Properties
| Compound Name | 2-methylhexan-3-ylsilane |
| PubChem CID | 173259699 |
| Molecular Formula | C7H18Si |
| Molecular Weight | 130.31 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | 2-methylhexan-3-ylsilane |
| SMILES | CCCC([SiH3])C(C)C |
| InChI | InChI=1S/C7H18Si/c1-4-5-7(8)6(2)3/h6-7H,4-5H2,1-3,8H3 |
| InChIKey | HIJCGUGGDZSMRC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexan-3-ylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexan-3-ylsilane?
The IUPAC name of 2-methylhexan-3-ylsilane (CID 173259699) is 2-methylhexan-3-ylsilane.
What is the SMILES notation for 2-methylhexan-3-ylsilane?
The canonical SMILES for 2-methylhexan-3-ylsilane is CCCC([SiH3])C(C)C.
What is the InChIKey of 2-methylhexan-3-ylsilane?
The InChIKey is HIJCGUGGDZSMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18Si/c1-4-5-7(8)6(2)3/h6-7H,4-5H2,1-3,8H3.
What are the key properties of 2-methylhexan-3-ylsilane?
2-methylhexan-3-ylsilane has a molecular weight of 130.31 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexan-3-ylsilane is sourced from PubChem (CID 173259699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).