About 1-bromo-1-iodobutane
1-bromo-1-iodobutane (PubChem CID 22138270) has the molecular formula C4H8BrI
and a molecular weight of 262.92 g/mol. Its IUPAC name is 1-bromo-1-iodobutane.
Molecular Properties
| Compound Name | 1-bromo-1-iodobutane |
| PubChem CID | 22138270 |
| Molecular Formula | C4H8BrI |
| Molecular Weight | 262.92 g/mol |
| Exact Mass | 261.89 |
| IUPAC Name | 1-bromo-1-iodobutane |
| SMILES | CCCC(Br)I |
| InChI | InChI=1S/C4H8BrI/c1-2-3-4(5)6/h4H,2-3H2,1H3 |
| InChIKey | SCFHQTNCYVPQIS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.92 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-1-iodobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-1-iodobutane?
The IUPAC name of 1-bromo-1-iodobutane (CID 22138270) is 1-bromo-1-iodobutane.
What is the SMILES notation for 1-bromo-1-iodobutane?
The canonical SMILES for 1-bromo-1-iodobutane is CCCC(Br)I.
What is the InChIKey of 1-bromo-1-iodobutane?
The InChIKey is SCFHQTNCYVPQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BrI/c1-2-3-4(5)6/h4H,2-3H2,1H3.
What are the key properties of 1-bromo-1-iodobutane?
1-bromo-1-iodobutane has a molecular weight of 262.92 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-1-iodobutane is sourced from PubChem (CID 22138270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).