About 2-bromopentanethioamide
2-bromopentanethioamide (PubChem CID 82670253) has the molecular formula C5H10BrNS
and a molecular weight of 196.11 g/mol. Its IUPAC name is 2-bromopentanethioamide.
Molecular Properties
| Compound Name | 2-bromopentanethioamide |
| PubChem CID | 82670253 |
| Molecular Formula | C5H10BrNS |
| Molecular Weight | 196.11 g/mol |
| Exact Mass | 194.97 |
| IUPAC Name | 2-bromopentanethioamide |
| SMILES | CCCC(Br)C(N)=S |
| InChI | InChI=1S/C5H10BrNS/c1-2-3-4(6)5(7)8/h4H,2-3H2,1H3,(H2,7,8) |
| InChIKey | LFWFIXOCGHZQGY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopentanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopentanethioamide?
The IUPAC name of 2-bromopentanethioamide (CID 82670253) is 2-bromopentanethioamide.
What is the SMILES notation for 2-bromopentanethioamide?
The canonical SMILES for 2-bromopentanethioamide is CCCC(Br)C(N)=S.
What is the InChIKey of 2-bromopentanethioamide?
The InChIKey is LFWFIXOCGHZQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10BrNS/c1-2-3-4(6)5(7)8/h4H,2-3H2,1H3,(H2,7,8).
What are the key properties of 2-bromopentanethioamide?
2-bromopentanethioamide has a molecular weight of 196.11 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopentanethioamide is sourced from PubChem (CID 82670253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).