About heptan-4-yl carbamodithioate
heptan-4-yl carbamodithioate (PubChem CID 158021173) has the molecular formula C8H17NS2
and a molecular weight of 191.36 g/mol. Its IUPAC name is heptan-4-yl carbamodithioate.
Molecular Properties
| Compound Name | heptan-4-yl carbamodithioate |
| PubChem CID | 158021173 |
| Molecular Formula | C8H17NS2 |
| Molecular Weight | 191.36 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | heptan-4-yl carbamodithioate |
| SMILES | CCCC(CCC)SC(N)=S |
| InChI | InChI=1S/C8H17NS2/c1-3-5-7(6-4-2)11-8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | PYVAYQQPCLZGCR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze heptan-4-yl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-4-yl carbamodithioate?
The IUPAC name of heptan-4-yl carbamodithioate (CID 158021173) is heptan-4-yl carbamodithioate.
What is the SMILES notation for heptan-4-yl carbamodithioate?
The canonical SMILES for heptan-4-yl carbamodithioate is CCCC(CCC)SC(N)=S.
What is the InChIKey of heptan-4-yl carbamodithioate?
The InChIKey is PYVAYQQPCLZGCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS2/c1-3-5-7(6-4-2)11-8(9)10/h7H,3-6H2,1-2H3,(H2,9,10).
What are the key properties of heptan-4-yl carbamodithioate?
heptan-4-yl carbamodithioate has a molecular weight of 191.36 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-4-yl carbamodithioate is sourced from PubChem (CID 158021173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).