About methanol;propyl carbamodithioate
methanol;propyl carbamodithioate (PubChem CID 174248667) has the molecular formula C5H13NOS2
and a molecular weight of 167.30 g/mol. Its IUPAC name is methanol;propyl carbamodithioate.
Molecular Properties
| Compound Name | methanol;propyl carbamodithioate |
| PubChem CID | 174248667 |
| Molecular Formula | C5H13NOS2 |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | methanol;propyl carbamodithioate |
| SMILES | CCCSC(N)=S.CO |
| InChI | InChI=1S/C4H9NS2.CH4O/c1-2-3-7-4(5)6;1-2/h2-3H2,1H3,(H2,5,6);2H,1H3 |
| InChIKey | VVULJHQHDKEIOO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methanol;propyl carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;propyl carbamodithioate?
The IUPAC name of methanol;propyl carbamodithioate (CID 174248667) is methanol;propyl carbamodithioate.
What is the SMILES notation for methanol;propyl carbamodithioate?
The canonical SMILES for methanol;propyl carbamodithioate is CCCSC(N)=S.CO.
What is the InChIKey of methanol;propyl carbamodithioate?
The InChIKey is VVULJHQHDKEIOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NS2.CH4O/c1-2-3-7-4(5)6;1-2/h2-3H2,1H3,(H2,5,6);2H,1H3.
What are the key properties of methanol;propyl carbamodithioate?
methanol;propyl carbamodithioate has a molecular weight of 167.30 g/mol, XLogP of 0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;propyl carbamodithioate is sourced from PubChem (CID 174248667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).