About CID 159121999
CID 159121999 (PubChem CID 159121999) has the molecular formula C5H11KNS2
and a molecular weight of 188.38 g/mol.
Molecular Properties
| Compound Name | CID 159121999 |
| PubChem CID | 159121999 |
| Molecular Formula | C5H11KNS2 |
| Molecular Weight | 188.38 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | — |
| SMILES | CCCCSC(N)=S.[K] |
| InChI | InChI=1S/C5H11NS2.K/c1-2-3-4-8-5(6)7;/h2-4H2,1H3,(H2,6,7); |
| InChIKey | KFURQRHZYFMJRC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 159121999 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159121999?
The IUPAC name of CID 159121999 (CID 159121999) is not available.
What is the SMILES notation for CID 159121999?
The canonical SMILES for CID 159121999 is CCCCSC(N)=S.[K].
What is the InChIKey of CID 159121999?
The InChIKey is KFURQRHZYFMJRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NS2.K/c1-2-3-4-8-5(6)7;/h2-4H2,1H3,(H2,6,7);.
What are the key properties of CID 159121999?
CID 159121999 has a molecular weight of 188.38 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159121999 is sourced from PubChem (CID 159121999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).