About butylsulfanylthiourea
butylsulfanylthiourea (PubChem CID 141412692) has the molecular formula C5H12N2S2
and a molecular weight of 164.30 g/mol. Its IUPAC name is butylsulfanylthiourea.
Molecular Properties
| Compound Name | butylsulfanylthiourea |
| PubChem CID | 141412692 |
| Molecular Formula | C5H12N2S2 |
| Molecular Weight | 164.30 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | butylsulfanylthiourea |
| SMILES | CCCCSNC(N)=S |
| InChI | InChI=1S/C5H12N2S2/c1-2-3-4-9-7-5(6)8/h2-4H2,1H3,(H3,6,7,8) |
| InChIKey | XTERKQRAUMUYDE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze butylsulfanylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylsulfanylthiourea?
The IUPAC name of butylsulfanylthiourea (CID 141412692) is butylsulfanylthiourea.
What is the SMILES notation for butylsulfanylthiourea?
The canonical SMILES for butylsulfanylthiourea is CCCCSNC(N)=S.
What is the InChIKey of butylsulfanylthiourea?
The InChIKey is XTERKQRAUMUYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2S2/c1-2-3-4-9-7-5(6)8/h2-4H2,1H3,(H3,6,7,8).
What are the key properties of butylsulfanylthiourea?
butylsulfanylthiourea has a molecular weight of 164.30 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylsulfanylthiourea is sourced from PubChem (CID 141412692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).